C13H12Cl3N3 — CID 126657459
2-methyl-4-[(4-methylphenyl)methyl]-6-(trichloromethyl)-1,3,5-triazine (PubChem CID 126657459) has the molecular formula C13H12Cl3N3 and a molecular weight of 316.62 g/mol. Its IUPAC name is 2-methyl-4-[(4-methylphenyl)methyl]-6-(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-methyl-4-[(4-methylphenyl)methyl]-6-(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 126657459 |
| Molecular Formula | C13H12Cl3N3 |
| Molecular Weight | 316.62 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 2-methyl-4-[(4-methylphenyl)methyl]-6-(trichloromethyl)-1,3,5-triazine |
| SMILES | Cc1ccc(Cc2nc(C)nc(C(Cl)(Cl)Cl)n2)cc1 |
| InChI | InChI=1S/C13H12Cl3N3/c1-8-3-5-10(6-4-8)7-11-17-9(2)18-12(19-11)13(14,15)16/h3-6H,7H2,1-2H3 |
| InChIKey | CKUQLQAURRZTDO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|