C11H7Cl3FN3 — CID 18989021
2-(4-fluorophenyl)-4-methyl-6-(trichloromethyl)-1,3,5-triazine (PubChem CID 18989021) has the molecular formula C11H7Cl3FN3 and a molecular weight of 306.56 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-methyl-6-(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-(4-fluorophenyl)-4-methyl-6-(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 18989021 |
| Molecular Formula | C11H7Cl3FN3 |
| Molecular Weight | 306.56 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 2-(4-fluorophenyl)-4-methyl-6-(trichloromethyl)-1,3,5-triazine |
| SMILES | Cc1nc(-c2ccc(F)cc2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C11H7Cl3FN3/c1-6-16-9(7-2-4-8(15)5-3-7)18-10(17-6)11(12,13)14/h2-5H,1H3 |
| InChIKey | YUSRAROLXZPWQX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|