C15H8ClF2N3 — CID 58752529
2-chloro-4,6-bis(4-fluorophenyl)-1,3,5-triazine (PubChem CID 58752529) has the molecular formula C15H8ClF2N3 and a molecular weight of 303.70 g/mol. Its IUPAC name is 2-chloro-4,6-bis(4-fluorophenyl)-1,3,5-triazine.
| Compound Name | 2-chloro-4,6-bis(4-fluorophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58752529 |
| Molecular Formula | C15H8ClF2N3 |
| Molecular Weight | 303.70 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 2-chloro-4,6-bis(4-fluorophenyl)-1,3,5-triazine |
| SMILES | Fc1ccc(-c2nc(Cl)nc(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C15H8ClF2N3/c16-15-20-13(9-1-5-11(17)6-2-9)19-14(21-15)10-3-7-12(18)8-4-10/h1-8H |
| InChIKey | MLVNYXXTYFTPRK-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.70 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |