C15H10ClN3 — CID 19698
2-chloro-4,6-diphenyl-1,3,5-triazine (PubChem CID 19698) has the molecular formula C15H10ClN3 and a molecular weight of 267.72 g/mol. Its IUPAC name is 2-chloro-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-chloro-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 19698 |
| Molecular Formula | C15H10ClN3 |
| Molecular Weight | 267.72 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-chloro-4,6-diphenyl-1,3,5-triazine |
| SMILES | Clc1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H10ClN3/c16-15-18-13(11-7-3-1-4-8-11)17-14(19-15)12-9-5-2-6-10-12/h1-10H |
| InChIKey | DDGPPAMADXTGTN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.72 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |