C10H13N — CID 15621251
(2R,3R)-2-benzyl-3-methylaziridine (PubChem CID 15621251) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is (2R,3R)-2-benzyl-3-methylaziridine.
| Compound Name | (2R,3R)-2-benzyl-3-methylaziridine |
|---|---|
| PubChem CID | 15621251 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | (2R,3R)-2-benzyl-3-methylaziridine |
| SMILES | C[C@H]1N[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C10H13N/c1-8-10(11-8)7-9-5-3-2-4-6-9/h2-6,8,10-11H,7H2,1H3/t8-,10-/m1/s1 |
| InChIKey | VITWGSRUBCMZAY-PSASIEDQSA-N |
| XLogP | 1.59 |
| TPSA | 21.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|