C19H23NS — CID 66233752
3-benzyl-5-methyl-2-phenyl-1,4-thiazepane (PubChem CID 66233752) has the molecular formula C19H23NS and a molecular weight of 297.47 g/mol. Its IUPAC name is 3-benzyl-5-methyl-2-phenyl-1,4-thiazepane.
| Compound Name | 3-benzyl-5-methyl-2-phenyl-1,4-thiazepane |
|---|---|
| PubChem CID | 66233752 |
| Molecular Formula | C19H23NS |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 3-benzyl-5-methyl-2-phenyl-1,4-thiazepane |
| SMILES | CC1CCSC(c2ccccc2)C(Cc2ccccc2)N1 |
| InChI | InChI=1S/C19H23NS/c1-15-12-13-21-19(17-10-6-3-7-11-17)18(20-15)14-16-8-4-2-5-9-16/h2-11,15,18-20H,12-14H2,1H3 |
| InChIKey | GKJMIEQNHCGADF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |