C21H25N — CID 18649593
(2S,4R)-4-benzyl-2-methyl-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]isoquinoline (PubChem CID 18649593) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is (2S,4R)-4-benzyl-2-methyl-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]isoquinoline.
| Compound Name | (2S,4R)-4-benzyl-2-methyl-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]isoquinoline |
|---|---|
| PubChem CID | 18649593 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (2S,4R)-4-benzyl-2-methyl-1,2,3,4,4a,5,6,10b-octahydrobenzo[f]isoquinoline |
| SMILES | C[C@H]1CC2c3ccccc3CCC2[C@@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C21H25N/c1-15-13-20-18-10-6-5-9-17(18)11-12-19(20)21(22-15)14-16-7-3-2-4-8-16/h2-10,15,19-22H,11-14H2,1H3/t15-,19?,20?,21+/m0/s1 |
| InChIKey | WAGFCXLPCOJMHX-NUDUCMMGSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |