C21H26ClN — CID 67854144
(3R,9bS)-2-methyl-3-[(3-methylphenyl)methyl]-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride (PubChem CID 67854144) has the molecular formula C21H26ClN and a molecular weight of 327.90 g/mol. Its IUPAC name is (3R,9bS)-2-methyl-3-[(3-methylphenyl)methyl]-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride.
| Compound Name | (3R,9bS)-2-methyl-3-[(3-methylphenyl)methyl]-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride |
|---|---|
| PubChem CID | 67854144 |
| Molecular Formula | C21H26ClN |
| Molecular Weight | 327.90 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (3R,9bS)-2-methyl-3-[(3-methylphenyl)methyl]-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole;hydrochloride |
| SMILES | Cc1cccc(C[C@@H]2C3CCc4ccccc4[C@H]3CN2C)c1.Cl |
| InChI | InChI=1S/C21H25N.ClH/c1-15-6-5-7-16(12-15)13-21-19-11-10-17-8-3-4-9-18(17)20(19)14-22(21)2;/h3-9,12,19-21H,10-11,13-14H2,1-2H3;1H/t19?,20-,21-;/m1./s1 |
| InChIKey | KQHTVPMKKFNPRH-IACNOSQHSA-N |
| XLogP | 4.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.90 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |