C22H24F3N — CID 54459093
(3R,9bS)-2-methyl-3-[(3-methylphenyl)methyl]-7-(trifluoromethyl)-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole (PubChem CID 54459093) has the molecular formula C22H24F3N and a molecular weight of 359.44 g/mol. Its IUPAC name is (3R,9bS)-2-methyl-3-[(3-methylphenyl)methyl]-7-(trifluoromethyl)-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole.
| Compound Name | (3R,9bS)-2-methyl-3-[(3-methylphenyl)methyl]-7-(trifluoromethyl)-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole |
|---|---|
| PubChem CID | 54459093 |
| Molecular Formula | C22H24F3N |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (3R,9bS)-2-methyl-3-[(3-methylphenyl)methyl]-7-(trifluoromethyl)-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindole |
| SMILES | Cc1cccc(C[C@@H]2C3CCc4cc(C(F)(F)F)ccc4[C@H]3CN2C)c1 |
| InChI | InChI=1S/C22H24F3N/c1-14-4-3-5-15(10-14)11-21-19-8-6-16-12-17(22(23,24)25)7-9-18(16)20(19)13-26(21)2/h3-5,7,9-10,12,19-21H,6,8,11,13H2,1-2H3/t19?,20-,21-/m1/s1 |
| InChIKey | XAIKGPCJPYSIPO-RWLBOTFQSA-N |
| XLogP | 5.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |