C12H16N2O — CID 155214736
(5R)-4-benzyl-1,5-dimethylimidazolidin-2-one (PubChem CID 155214736) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (5R)-4-benzyl-1,5-dimethylimidazolidin-2-one.
| Compound Name | (5R)-4-benzyl-1,5-dimethylimidazolidin-2-one |
|---|---|
| PubChem CID | 155214736 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (5R)-4-benzyl-1,5-dimethylimidazolidin-2-one |
| SMILES | C[C@@H]1C(Cc2ccccc2)NC(=O)N1C |
| InChI | InChI=1S/C12H16N2O/c1-9-11(13-12(15)14(9)2)8-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3,(H,13,15)/t9-,11?/m1/s1 |
| InChIKey | XJQVRKWFLGNYGT-BFHBGLAWSA-N |
| XLogP | 1.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |