C18H18N2 — CID 139215264
2,5-dibenzyl-2,5-dihydropyrazine (PubChem CID 139215264) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 2,5-dibenzyl-2,5-dihydropyrazine.
| Compound Name | 2,5-dibenzyl-2,5-dihydropyrazine |
|---|---|
| PubChem CID | 139215264 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2,5-dibenzyl-2,5-dihydropyrazine |
| SMILES | C1=NC(Cc2ccccc2)C=NC1Cc1ccccc1 |
| InChI | InChI=1S/C18H18N2/c1-3-7-15(8-4-1)11-17-13-20-18(14-19-17)12-16-9-5-2-6-10-16/h1-10,13-14,17-18H,11-12H2 |
| InChIKey | FJRBKCDIRGFMDU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |