C10H11N — CID 145299473
2-benzyl-1,2-dihydroazete (PubChem CID 145299473) has the molecular formula C10H11N and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-benzyl-1,2-dihydroazete.
| Compound Name | 2-benzyl-1,2-dihydroazete |
|---|---|
| PubChem CID | 145299473 |
| Molecular Formula | C10H11N |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 2-benzyl-1,2-dihydroazete |
| SMILES | C1=CC(Cc2ccccc2)N1 |
| InChI | InChI=1S/C10H11N/c1-2-4-9(5-3-1)8-10-6-7-11-10/h1-7,10-11H,8H2 |
| InChIKey | GCLHAFZBTFMIRY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |