About 3-benzylazetidine;hydrochloride
3-benzylazetidine;hydrochloride (PubChem CID 54592835) has the molecular formula C10H14ClN
and a molecular weight of 183.68 g/mol. Its IUPAC name is 3-benzylazetidine;hydrochloride.
Molecular Properties
| Compound Name | 3-benzylazetidine;hydrochloride |
| PubChem CID | 54592835 |
| Molecular Formula | C10H14ClN |
| Molecular Weight | 183.68 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 3-benzylazetidine;hydrochloride |
| SMILES | Cl.c1ccc(CC2CNC2)cc1 |
| InChI | InChI=1S/C10H13N.ClH/c1-2-4-9(5-3-1)6-10-7-11-8-10;/h1-5,10-11H,6-8H2;1H |
| InChIKey | NQSYCYSKQSQIBX-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.68 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-benzylazetidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylazetidine;hydrochloride?
The IUPAC name of 3-benzylazetidine;hydrochloride (CID 54592835) is 3-benzylazetidine;hydrochloride.
What is the SMILES notation for 3-benzylazetidine;hydrochloride?
The canonical SMILES for 3-benzylazetidine;hydrochloride is Cl.c1ccc(CC2CNC2)cc1.
What is the InChIKey of 3-benzylazetidine;hydrochloride?
The InChIKey is NQSYCYSKQSQIBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N.ClH/c1-2-4-9(5-3-1)6-10-7-11-8-10;/h1-5,10-11H,6-8H2;1H.
What are the key properties of 3-benzylazetidine;hydrochloride?
3-benzylazetidine;hydrochloride has a molecular weight of 183.68 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylazetidine;hydrochloride is sourced from PubChem (CID 54592835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).