C16H21NO — CID 11195903
(2S,5R)-2-benzyl-5-butyl-2,5-dihydro-1H-pyridin-6-one (PubChem CID 11195903) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is (2S,5R)-2-benzyl-5-butyl-2,5-dihydro-1H-pyridin-6-one.
| Compound Name | (2S,5R)-2-benzyl-5-butyl-2,5-dihydro-1H-pyridin-6-one |
|---|---|
| PubChem CID | 11195903 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (2S,5R)-2-benzyl-5-butyl-2,5-dihydro-1H-pyridin-6-one |
| SMILES | CCCC[C@@H]1C=C[C@H](Cc2ccccc2)NC1=O |
| InChI | InChI=1S/C16H21NO/c1-2-3-9-14-10-11-15(17-16(14)18)12-13-7-5-4-6-8-13/h4-8,10-11,14-15H,2-3,9,12H2,1H3,(H,17,18)/t14-,15-/m1/s1 |
| InChIKey | UOIHQZMAQYXZRI-HUUCEWRRSA-N |
| XLogP | 3.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|