C15H21NO2 — CID 11253654
(4R,5S)-4-butyl-5-(2-phenylethyl)-1,3-oxazolidin-2-one (PubChem CID 11253654) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (4R,5S)-4-butyl-5-(2-phenylethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-4-butyl-5-(2-phenylethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11253654 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (4R,5S)-4-butyl-5-(2-phenylethyl)-1,3-oxazolidin-2-one |
| SMILES | CCCC[C@H]1NC(=O)O[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C15H21NO2/c1-2-3-9-13-14(18-15(17)16-13)11-10-12-7-5-4-6-8-12/h4-8,13-14H,2-3,9-11H2,1H3,(H,16,17)/t13-,14+/m1/s1 |
| InChIKey | MSABOTJLLRZNHR-KGLIPLIRSA-N |
| XLogP | 3.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |