C22H33NO3 — CID 11068360
(4R,5R)-4-methyl-5-(3-oxo-12-phenyldodecyl)-1,3-oxazolidin-2-one (PubChem CID 11068360) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is (4R,5R)-4-methyl-5-(3-oxo-12-phenyldodecyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-4-methyl-5-(3-oxo-12-phenyldodecyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11068360 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (4R,5R)-4-methyl-5-(3-oxo-12-phenyldodecyl)-1,3-oxazolidin-2-one |
| SMILES | C[C@H]1NC(=O)O[C@@H]1CCC(=O)CCCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C22H33NO3/c1-18-21(26-22(25)23-18)17-16-20(24)15-11-6-4-2-3-5-8-12-19-13-9-7-10-14-19/h7,9-10,13-14,18,21H,2-6,8,11-12,15-17H2,1H3,(H,23,25)/t18-,21-/m1/s1 |
| InChIKey | YRHXIUPTJWXYMY-WIYYLYMNSA-N |
| XLogP | 5.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|