C16H22O3 — CID 163679114
1-(1,3-dioxolan-2-yl)-7-phenylheptan-3-one (PubChem CID 163679114) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(1,3-dioxolan-2-yl)-7-phenylheptan-3-one.
| Compound Name | 1-(1,3-dioxolan-2-yl)-7-phenylheptan-3-one |
|---|---|
| PubChem CID | 163679114 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 1-(1,3-dioxolan-2-yl)-7-phenylheptan-3-one |
| SMILES | O=C(CCCCc1ccccc1)CCC1OCCO1 |
| InChI | InChI=1S/C16H22O3/c17-15(10-11-16-18-12-13-19-16)9-5-4-8-14-6-2-1-3-7-14/h1-3,6-7,16H,4-5,8-13H2 |
| InChIKey | JJHPCHRXHLGAMG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|