C19H37NO3 — CID 15847421
5-(hydroxymethyl)-4-pentadecyl-1,3-oxazolidin-2-one (PubChem CID 15847421) has the molecular formula C19H37NO3 and a molecular weight of 327.51 g/mol. Its IUPAC name is 5-(hydroxymethyl)-4-pentadecyl-1,3-oxazolidin-2-one.
| Compound Name | 5-(hydroxymethyl)-4-pentadecyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15847421 |
| Molecular Formula | C19H37NO3 |
| Molecular Weight | 327.51 g/mol |
| Exact Mass | 327.28 |
| IUPAC Name | 5-(hydroxymethyl)-4-pentadecyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCCCCCCCCCC1NC(=O)OC1CO |
| InChI | InChI=1S/C19H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-18(16-21)23-19(22)20-17/h17-18,21H,2-16H2,1H3,(H,20,22) |
| InChIKey | ZSFCVPQVRKLEHL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|