C12H21NO5 — CID 46236991
(4R,5S)-5-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-propyl-1,3-oxazolidin-2-one (PubChem CID 46236991) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is (4R,5S)-5-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-propyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-5-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-propyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 46236991 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (4R,5S)-5-[(4S,5S)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-propyl-1,3-oxazolidin-2-one |
| SMILES | CCC[C@H]1NC(=O)O[C@@H]1[C@@H]1OC(C)(C)O[C@H]1CO |
| InChI | InChI=1S/C12H21NO5/c1-4-5-7-9(16-11(15)13-7)10-8(6-14)17-12(2,3)18-10/h7-10,14H,4-6H2,1-3H3,(H,13,15)/t7-,8+,9+,10-/m1/s1 |
| InChIKey | PNKXOFXXGHLGOJ-XFWSIPNHSA-N |
| XLogP | 0.78 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |