C25H36N2O14 — CID 101165863
diethyl 2-[(4S,5R)-5-[(4R,5R)-5-[(4S,5R)-4-(1,3-diethoxy-1,3-dioxopropan-2-yl)-2-oxo-1,3-oxazolidin-5-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-1,3-oxazolidin-4-yl]propanedioate (PubChem CID 101165863) has the molecular formula C25H36N2O14 and a molecular weight of 588.56 g/mol. Its IUPAC name is diethyl 2-[(4S,5R)-5-[(4R,5R)-5-[(4S,5R)-4-(1,3-diethoxy-1,3-dioxopropan-2-yl)-2-oxo-1,3-oxazolidin-5-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-1,3-oxazolidin-4-yl]propanedioate.
| Compound Name | diethyl 2-[(4S,5R)-5-[(4R,5R)-5-[(4S,5R)-4-(1,3-diethoxy-1,3-dioxopropan-2-yl)-2-oxo-1,3-oxazolidin-5-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-1,3-oxazolidin-4-yl]propanedioate |
|---|---|
| PubChem CID | 101165863 |
| Molecular Formula | C25H36N2O14 |
| Molecular Weight | 588.56 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | diethyl 2-[(4S,5R)-5-[(4R,5R)-5-[(4S,5R)-4-(1,3-diethoxy-1,3-dioxopropan-2-yl)-2-oxo-1,3-oxazolidin-5-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxo-1,3-oxazolidin-4-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]1NC(=O)O[C@H]1[C@H]1OC(C)(C)O[C@@H]1[C@@H]1OC(=O)N[C@H]1C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C25H36N2O14/c1-7-34-19(28)11(20(29)35-8-2)13-15(38-23(32)26-13)17-18(41-25(5,6)40-17)16-14(27-24(33)39-16)12(21(30)36-9-3)22(31)37-10-4/h11-18H,7-10H2,1-6H3,(H,26,32)(H,27,33)/t13-,14-,15+,16+,17+,18+/m0/s1 |
| InChIKey | GWERXGQBCSPWLX-DWMDIXPDSA-N |
| XLogP | -0.05 |
| TPSA | 200.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.56 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|