C13H19ClO6 — CID 102129158
diethyl 2-[(3R,5S)-5-chloro-5-methyl-2-oxooxan-3-yl]propanedioate (PubChem CID 102129158) has the molecular formula C13H19ClO6 and a molecular weight of 306.74 g/mol. Its IUPAC name is diethyl 2-[(3R,5S)-5-chloro-5-methyl-2-oxooxan-3-yl]propanedioate.
| Compound Name | diethyl 2-[(3R,5S)-5-chloro-5-methyl-2-oxooxan-3-yl]propanedioate |
|---|---|
| PubChem CID | 102129158 |
| Molecular Formula | C13H19ClO6 |
| Molecular Weight | 306.74 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | diethyl 2-[(3R,5S)-5-chloro-5-methyl-2-oxooxan-3-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@H]1C[C@](C)(Cl)COC1=O |
| InChI | InChI=1S/C13H19ClO6/c1-4-18-11(16)9(12(17)19-5-2)8-6-13(3,14)7-20-10(8)15/h8-9H,4-7H2,1-3H3/t8-,13+/m1/s1 |
| InChIKey | GZJLCLNRCCNUQX-OQPBUACISA-N |
| XLogP | 1.29 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.74 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|