About ethyl 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate
ethyl 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate (PubChem CID 147020402) has the molecular formula C9H14O5
and a molecular weight of 202.21 g/mol. Its IUPAC name is ethyl 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate.
Analyze ethyl 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate?
The IUPAC name of ethyl 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate (CID 147020402) is ethyl 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate.
What is the SMILES notation for ethyl 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate?
The canonical SMILES for ethyl 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate is CCOC(=O)CC1OC(C)(C)OC1=O.
What is the InChIKey of ethyl 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate?
The InChIKey is AVOWRQFMZHDBMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O5/c1-4-12-7(10)5-6-8(11)14-9(2,3)13-6/h6H,4-5H2,1-3H3.
What are the key properties of ethyl 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate?
ethyl 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate has a molecular weight of 202.21 g/mol, XLogP of 0.62, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)acetate is sourced from PubChem (CID 147020402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).