C10H14O6 — CID 71344322
ethyl 2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)acetate (PubChem CID 71344322) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is ethyl 2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)acetate.
| Compound Name | ethyl 2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)acetate |
|---|---|
| PubChem CID | 71344322 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | ethyl 2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)acetate |
| SMILES | CCOC(=O)CC1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C10H14O6/c1-4-14-7(11)5-6-8(12)15-10(2,3)16-9(6)13/h6H,4-5H2,1-3H3 |
| InChIKey | HMVUELUFHBSKGA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|