C19H22O8 — CID 25213167
diethyl 2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-phenylpropanedioate (PubChem CID 25213167) has the molecular formula C19H22O8 and a molecular weight of 378.38 g/mol. Its IUPAC name is diethyl 2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-phenylpropanedioate.
| Compound Name | diethyl 2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-phenylpropanedioate |
|---|---|
| PubChem CID | 25213167 |
| Molecular Formula | C19H22O8 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | diethyl 2-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-2-phenylpropanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)(c1ccccc1)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C19H22O8/c1-5-24-16(22)19(17(23)25-6-2,12-10-8-7-9-11-12)13-14(20)26-18(3,4)27-15(13)21/h7-11,13H,5-6H2,1-4H3 |
| InChIKey | CAVUWVBBYSYUDJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|