About ethyl 2-(1,3-dioxoinden-2-yl)acetate
ethyl 2-(1,3-dioxoinden-2-yl)acetate (PubChem CID 13130488) has the molecular formula C13H12O4
and a molecular weight of 232.23 g/mol. Its IUPAC name is ethyl 2-(1,3-dioxoinden-2-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-(1,3-dioxoinden-2-yl)acetate |
| PubChem CID | 13130488 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | ethyl 2-(1,3-dioxoinden-2-yl)acetate |
| SMILES | CCOC(=O)CC1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H12O4/c1-2-17-11(14)7-10-12(15)8-5-3-4-6-9(8)13(10)16/h3-6,10H,2,7H2,1H3 |
| InChIKey | INIMHSPCACQSAJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(1,3-dioxoinden-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(1,3-dioxoinden-2-yl)acetate?
The IUPAC name of ethyl 2-(1,3-dioxoinden-2-yl)acetate (CID 13130488) is ethyl 2-(1,3-dioxoinden-2-yl)acetate.
What is the SMILES notation for ethyl 2-(1,3-dioxoinden-2-yl)acetate?
The canonical SMILES for ethyl 2-(1,3-dioxoinden-2-yl)acetate is CCOC(=O)CC1C(=O)c2ccccc2C1=O.
What is the InChIKey of ethyl 2-(1,3-dioxoinden-2-yl)acetate?
The InChIKey is INIMHSPCACQSAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O4/c1-2-17-11(14)7-10-12(15)8-5-3-4-6-9(8)13(10)16/h3-6,10H,2,7H2,1H3.
What are the key properties of ethyl 2-(1,3-dioxoinden-2-yl)acetate?
ethyl 2-(1,3-dioxoinden-2-yl)acetate has a molecular weight of 232.23 g/mol, XLogP of 1.63, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(1,3-dioxoinden-2-yl)acetate is sourced from PubChem (CID 13130488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).