C8H14O5 — CID 163955242
(5R)-5-(2-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-one (PubChem CID 163955242) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is (5R)-5-(2-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-one.
| Compound Name | (5R)-5-(2-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 163955242 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (5R)-5-(2-hydroxy-2-methoxyethyl)-2,2-dimethyl-1,3-dioxolan-4-one |
| SMILES | COC(O)C[C@H]1OC(C)(C)OC1=O |
| InChI | InChI=1S/C8H14O5/c1-8(2)12-5(7(10)13-8)4-6(9)11-3/h5-6,9H,4H2,1-3H3/t5-,6?/m1/s1 |
| InChIKey | SCTXKBCMDPZWQG-LWOQYNTDSA-N |
| XLogP | 0.02 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|