About (5S)-5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxolan-4-one
(5S)-5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxolan-4-one (PubChem CID 11229802) has the molecular formula C7H11BrO3
and a molecular weight of 223.07 g/mol. Its IUPAC name is (5S)-5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxolan-4-one.
Molecular Properties
| Compound Name | (5S)-5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxolan-4-one |
| PubChem CID | 11229802 |
| Molecular Formula | C7H11BrO3 |
| Molecular Weight | 223.07 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | (5S)-5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxolan-4-one |
| SMILES | CC1(C)OC(=O)[C@H](CCBr)O1 |
| InChI | InChI=1S/C7H11BrO3/c1-7(2)10-5(3-4-8)6(9)11-7/h5H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | OUQKGLRPEIEHJI-YFKPBYRVSA-N |
| XLogP | 1.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.07 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxolan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxolan-4-one?
The IUPAC name of (5S)-5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxolan-4-one (CID 11229802) is (5S)-5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxolan-4-one.
What is the SMILES notation for (5S)-5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxolan-4-one?
The canonical SMILES for (5S)-5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxolan-4-one is CC1(C)OC(=O)[C@H](CCBr)O1.
What is the InChIKey of (5S)-5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxolan-4-one?
The InChIKey is OUQKGLRPEIEHJI-YFKPBYRVSA-N. The full InChI is InChI=1S/C7H11BrO3/c1-7(2)10-5(3-4-8)6(9)11-7/h5H,3-4H2,1-2H3/t5-/m0/s1.
What are the key properties of (5S)-5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxolan-4-one?
(5S)-5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxolan-4-one has a molecular weight of 223.07 g/mol, XLogP of 1.45, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-(2-bromoethyl)-2,2-dimethyl-1,3-dioxolan-4-one is sourced from PubChem (CID 11229802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).