C13H9F5O5 — CID 89191791
(2,3,4,5,6-pentafluorophenyl) 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate (PubChem CID 89191791) has the molecular formula C13H9F5O5 and a molecular weight of 340.20 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate |
|---|---|
| PubChem CID | 89191791 |
| Molecular Formula | C13H9F5O5 |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-[(4S)-2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl]acetate |
| SMILES | CC1(C)OC(=O)[C@H](CC(=O)Oc2c(F)c(F)c(F)c(F)c2F)O1 |
| InChI | InChI=1S/C13H9F5O5/c1-13(2)22-4(12(20)23-13)3-5(19)21-11-9(17)7(15)6(14)8(16)10(11)18/h4H,3H2,1-2H3/t4-/m0/s1 |
| InChIKey | OQMIOFHPDDXUMY-BYPYZUCNSA-N |
| XLogP | 2.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|