C13H16O10 — CID 129027488
bis(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl) propanedioate (PubChem CID 129027488) has the molecular formula C13H16O10 and a molecular weight of 332.26 g/mol. Its IUPAC name is bis(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl) propanedioate.
| Compound Name | bis(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl) propanedioate |
|---|---|
| PubChem CID | 129027488 |
| Molecular Formula | C13H16O10 |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | bis(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl) propanedioate |
| SMILES | CC1(C)OC(=O)C(OC(=O)CC(=O)OC2OC(C)(C)OC2=O)O1 |
| InChI | InChI=1S/C13H16O10/c1-12(2)20-8(16)10(22-12)18-6(14)5-7(15)19-11-9(17)21-13(3,4)23-11/h10-11H,5H2,1-4H3 |
| InChIKey | SXLPTHYPIGJYTB-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|