C14H16O7 — CID 176864765
methyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)bicyclo[1.1.1]pentane-1-carboxylate (PubChem CID 176864765) has the molecular formula C14H16O7 and a molecular weight of 296.27 g/mol. Its IUPAC name is methyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)bicyclo[1.1.1]pentane-1-carboxylate.
| Compound Name | methyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)bicyclo[1.1.1]pentane-1-carboxylate |
|---|---|
| PubChem CID | 176864765 |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | methyl 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxane-5-carbonyl)bicyclo[1.1.1]pentane-1-carboxylate |
| SMILES | COC(=O)C12CC(C(=O)C3C(=O)OC(C)(C)OC3=O)(C1)C2 |
| InChI | InChI=1S/C14H16O7/c1-12(2)20-9(16)7(10(17)21-12)8(15)13-4-14(5-13,6-13)11(18)19-3/h7H,4-6H2,1-3H3 |
| InChIKey | UYRUFTOYYFSYKC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|