C17H29FO5 — CID 178126584
ethane;5-[3-(fluoromethyl)-1-methylcyclobutanecarbonyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 178126584) has the molecular formula C17H29FO5 and a molecular weight of 332.41 g/mol. Its IUPAC name is ethane;5-[3-(fluoromethyl)-1-methylcyclobutanecarbonyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | ethane;5-[3-(fluoromethyl)-1-methylcyclobutanecarbonyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 178126584 |
| Molecular Formula | C17H29FO5 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | ethane;5-[3-(fluoromethyl)-1-methylcyclobutanecarbonyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC.CC.CC1(C)OC(=O)C(C(=O)C2(C)CC(CF)C2)C(=O)O1 |
| InChI | InChI=1S/C13H17FO5.2C2H6/c1-12(2)18-10(16)8(11(17)19-12)9(15)13(3)4-7(5-13)6-14;2*1-2/h7-8H,4-6H2,1-3H3;2*1-2H3 |
| InChIKey | IABWOBKVJYAIHY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|