C9H10O6 — CID 142275191
3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-oxopropanal (PubChem CID 142275191) has the molecular formula C9H10O6 and a molecular weight of 214.17 g/mol. Its IUPAC name is 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-oxopropanal.
| Compound Name | 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-oxopropanal |
|---|---|
| PubChem CID | 142275191 |
| Molecular Formula | C9H10O6 |
| Molecular Weight | 214.17 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 3-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-3-oxopropanal |
| SMILES | CC1(C)OC(=O)C(C(=O)CC=O)C(=O)O1 |
| InChI | InChI=1S/C9H10O6/c1-9(2)14-7(12)6(8(13)15-9)5(11)3-4-10/h4,6H,3H2,1-2H3 |
| InChIKey | SGNLVPWDOUVIKX-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.17 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|