C17H26O6 — CID 100935593
2,2-dimethyl-5-(3-oxoundecanoyl)-1,3-dioxane-4,6-dione (PubChem CID 100935593) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is 2,2-dimethyl-5-(3-oxoundecanoyl)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-(3-oxoundecanoyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 100935593 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2,2-dimethyl-5-(3-oxoundecanoyl)-1,3-dioxane-4,6-dione |
| SMILES | CCCCCCCCC(=O)CC(=O)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C17H26O6/c1-4-5-6-7-8-9-10-12(18)11-13(19)14-15(20)22-17(2,3)23-16(14)21/h14H,4-11H2,1-3H3 |
| InChIKey | UCJGLVXUFAJJKF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|