C15H16O6 — CID 23402799
5-[2-(3-methoxyphenyl)acetyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 23402799) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is 5-[2-(3-methoxyphenyl)acetyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[2-(3-methoxyphenyl)acetyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 23402799 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 5-[2-(3-methoxyphenyl)acetyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1cccc(CC(=O)C2C(=O)OC(C)(C)OC2=O)c1 |
| InChI | InChI=1S/C15H16O6/c1-15(2)20-13(17)12(14(18)21-15)11(16)8-9-5-4-6-10(7-9)19-3/h4-7,12H,8H2,1-3H3 |
| InChIKey | IIDIZZFUSXWUTG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|