C15H22N2O2 — CID 79659383
1-(1,4-dimethylpiperazin-2-yl)-2-(3-methoxyphenyl)ethanone (PubChem CID 79659383) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-2-yl)-2-(3-methoxyphenyl)ethanone.
| Compound Name | 1-(1,4-dimethylpiperazin-2-yl)-2-(3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 79659383 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-2-yl)-2-(3-methoxyphenyl)ethanone |
| SMILES | COc1cccc(CC(=O)C2CN(C)CCN2C)c1 |
| InChI | InChI=1S/C15H22N2O2/c1-16-7-8-17(2)14(11-16)15(18)10-12-5-4-6-13(9-12)19-3/h4-6,9,14H,7-8,10-11H2,1-3H3 |
| InChIKey | JNZFPDRMQQBNIR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |