C16H16O5 — CID 163247294
2,2-dimethyl-5-(1-phenylcyclopropanecarbonyl)-1,3-dioxane-4,6-dione (PubChem CID 163247294) has the molecular formula C16H16O5 and a molecular weight of 288.30 g/mol. Its IUPAC name is 2,2-dimethyl-5-(1-phenylcyclopropanecarbonyl)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-(1-phenylcyclopropanecarbonyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 163247294 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 2,2-dimethyl-5-(1-phenylcyclopropanecarbonyl)-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(C(=O)C2(c3ccccc3)CC2)C(=O)O1 |
| InChI | InChI=1S/C16H16O5/c1-15(2)20-13(18)11(14(19)21-15)12(17)16(8-9-16)10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | MMOLKULTUFIJMO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|