C14H17NO6 — CID 151489335
3-(3-methoxycarbonylbicyclo[1.1.1]pentane-1-carbonyl)-4-oxopiperidine-1-carboxylic acid (PubChem CID 151489335) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 3-(3-methoxycarbonylbicyclo[1.1.1]pentane-1-carbonyl)-4-oxopiperidine-1-carboxylic acid.
| Compound Name | 3-(3-methoxycarbonylbicyclo[1.1.1]pentane-1-carbonyl)-4-oxopiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 151489335 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-(3-methoxycarbonylbicyclo[1.1.1]pentane-1-carbonyl)-4-oxopiperidine-1-carboxylic acid |
| SMILES | COC(=O)C12CC(C(=O)C3CN(C(=O)O)CCC3=O)(C1)C2 |
| InChI | InChI=1S/C14H17NO6/c1-21-11(18)14-5-13(6-14,7-14)10(17)8-4-15(12(19)20)3-2-9(8)16/h8H,2-7H2,1H3,(H,19,20) |
| InChIKey | PODCIFBPXSYYCM-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|