C7H9NO4 — CID 130647616
(5R)-5-(isocyanatomethyl)-2,2-dimethyl-1,3-dioxolan-4-one (PubChem CID 130647616) has the molecular formula C7H9NO4 and a molecular weight of 171.15 g/mol. Its IUPAC name is (5R)-5-(isocyanatomethyl)-2,2-dimethyl-1,3-dioxolan-4-one.
| Compound Name | (5R)-5-(isocyanatomethyl)-2,2-dimethyl-1,3-dioxolan-4-one |
|---|---|
| PubChem CID | 130647616 |
| Molecular Formula | C7H9NO4 |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | (5R)-5-(isocyanatomethyl)-2,2-dimethyl-1,3-dioxolan-4-one |
| SMILES | CC1(C)OC(=O)[C@@H](CN=C=O)O1 |
| InChI | InChI=1S/C7H9NO4/c1-7(2)11-5(3-8-4-9)6(10)12-7/h5H,3H2,1-2H3/t5-/m1/s1 |
| InChIKey | YPILCADZCWGCFJ-RXMQYKEDSA-N |
| XLogP | 0.00 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|