C7H11NO3 — CID 71331594
4-(isocyanatomethyl)-2,2-dimethyl-1,3-dioxolane (PubChem CID 71331594) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 4-(isocyanatomethyl)-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-(isocyanatomethyl)-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 71331594 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 4-(isocyanatomethyl)-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OCC(CN=C=O)O1 |
| InChI | InChI=1S/C7H11NO3/c1-7(2)10-4-6(11-7)3-8-5-9/h6H,3-4H2,1-2H3 |
| InChIKey | KCIFCIGZABQNCV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|