C7H13ClN2O2 — CID 175060692
N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine;hydrochloride (PubChem CID 175060692) has the molecular formula C7H13ClN2O2 and a molecular weight of 192.65 g/mol. Its IUPAC name is N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine;hydrochloride.
| Compound Name | N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine;hydrochloride |
|---|---|
| PubChem CID | 175060692 |
| Molecular Formula | C7H13ClN2O2 |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | N'-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]methanediimine;hydrochloride |
| SMILES | CC1(C)OCC(CN=C=N)O1.Cl |
| InChI | InChI=1S/C7H12N2O2.ClH/c1-7(2)10-4-6(11-7)3-9-5-8;/h6,8H,3-4H2,1-2H3;1H |
| InChIKey | JCJZUCNDJPCKBJ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 54.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|