C7H13NO4 — CID 13425316
2,2-dimethyl-4-(2-nitroethyl)-1,3-dioxolane (PubChem CID 13425316) has the molecular formula C7H13NO4 and a molecular weight of 175.18 g/mol. Its IUPAC name is 2,2-dimethyl-4-(2-nitroethyl)-1,3-dioxolane.
| Compound Name | 2,2-dimethyl-4-(2-nitroethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 13425316 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 2,2-dimethyl-4-(2-nitroethyl)-1,3-dioxolane |
| SMILES | CC1(C)OCC(CC[N+](=O)[O-])O1 |
| InChI | InChI=1S/C7H13NO4/c1-7(2)11-5-6(12-7)3-4-8(9)10/h6H,3-5H2,1-2H3 |
| InChIKey | XJZDGGSLGJBVJX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|