C9H16N2O4S — CID 142086890
(Z)-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-1-methylsulfanyl-2-nitroethenamine (PubChem CID 142086890) has the molecular formula C9H16N2O4S and a molecular weight of 248.30 g/mol. Its IUPAC name is (Z)-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-1-methylsulfanyl-2-nitroethenamine.
| Compound Name | (Z)-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-1-methylsulfanyl-2-nitroethenamine |
|---|---|
| PubChem CID | 142086890 |
| Molecular Formula | C9H16N2O4S |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | (Z)-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-1-methylsulfanyl-2-nitroethenamine |
| SMILES | CS/C(=C\[N+](=O)[O-])NCC1COC(C)(C)O1 |
| InChI | InChI=1S/C9H16N2O4S/c1-9(2)14-6-7(15-9)4-10-8(16-3)5-11(12)13/h5,7,10H,4,6H2,1-3H3/b8-5- |
| InChIKey | XTVVCQVDZHGXBJ-YVMONPNESA-N |
| XLogP | 1.17 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|