C13H15BrN2O5 — CID 107389093
4-bromo-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-nitrobenzamide (PubChem CID 107389093) has the molecular formula C13H15BrN2O5 and a molecular weight of 359.18 g/mol. Its IUPAC name is 4-bromo-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-nitrobenzamide.
| Compound Name | 4-bromo-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 107389093 |
| Molecular Formula | C13H15BrN2O5 |
| Molecular Weight | 359.18 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 4-bromo-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-nitrobenzamide |
| SMILES | CC1(C)OCC(CNC(=O)c2ccc(Br)c([N+](=O)[O-])c2)O1 |
| InChI | InChI=1S/C13H15BrN2O5/c1-13(2)20-7-9(21-13)6-15-12(17)8-3-4-10(14)11(5-8)16(18)19/h3-5,9H,6-7H2,1-2H3,(H,15,17) |
| InChIKey | SCLJUSJBRNFWDT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.18 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|