C13H17N3O5 — CID 107389651
3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]-4-nitrobenzamide (PubChem CID 107389651) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is 3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]-4-nitrobenzamide.
| Compound Name | 3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 107389651 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-[(2,2-dimethyl-1,3-dioxolan-4-yl)methylamino]-4-nitrobenzamide |
| SMILES | CC1(C)OCC(CNc2cc(C(N)=O)ccc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C13H17N3O5/c1-13(2)20-7-9(21-13)6-15-10-5-8(12(14)17)3-4-11(10)16(18)19/h3-5,9,15H,6-7H2,1-2H3,(H2,14,17) |
| InChIKey | ZJDJVWBLJXKLND-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|