C13H16ClNO3 — CID 103762524
4-chloro-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzamide (PubChem CID 103762524) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is 4-chloro-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzamide.
| Compound Name | 4-chloro-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 103762524 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 4-chloro-N-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]benzamide |
| SMILES | CC1(C)OCC(CNC(=O)c2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C13H16ClNO3/c1-13(2)17-8-11(18-13)7-15-12(16)9-3-5-10(14)6-4-9/h3-6,11H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | PWEYAYQBVNVEBD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |