C15H18ClNO3 — CID 18583938
4-chloro-N-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)benzamide (PubChem CID 18583938) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is 4-chloro-N-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)benzamide.
| Compound Name | 4-chloro-N-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 18583938 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 4-chloro-N-(1,4-dioxaspiro[4.4]nonan-3-ylmethyl)benzamide |
| SMILES | O=C(NCC1COC2(CCCC2)O1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H18ClNO3/c16-12-5-3-11(4-6-12)14(18)17-9-13-10-19-15(20-13)7-1-2-8-15/h3-6,13H,1-2,7-10H2,(H,17,18) |
| InChIKey | MKCJBJVYHVEZIJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |