C19H27NO4 — CID 41412206
4-butoxy-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]benzamide (PubChem CID 41412206) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 4-butoxy-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]benzamide.
| Compound Name | 4-butoxy-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 41412206 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 4-butoxy-N-[[(3S)-1,4-dioxaspiro[4.4]nonan-3-yl]methyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NC[C@H]2COC3(CCCC3)O2)cc1 |
| InChI | InChI=1S/C19H27NO4/c1-2-3-12-22-16-8-6-15(7-9-16)18(21)20-13-17-14-23-19(24-17)10-4-5-11-19/h6-9,17H,2-5,10-14H2,1H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | RQYXUILKFXXATQ-KRWDZBQOSA-N |
| XLogP | 3.28 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|