C18H30O10 — CID 162028248
5-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)pentanoic acid;2-hydroxy-7-methoxy-7-oxoheptanoic acid (PubChem CID 162028248) has the molecular formula C18H30O10 and a molecular weight of 406.43 g/mol. Its IUPAC name is 5-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)pentanoic acid;2-hydroxy-7-methoxy-7-oxoheptanoic acid.
| Compound Name | 5-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)pentanoic acid;2-hydroxy-7-methoxy-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 162028248 |
| Molecular Formula | C18H30O10 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 5-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-yl)pentanoic acid;2-hydroxy-7-methoxy-7-oxoheptanoic acid |
| SMILES | CC1(C)OC(=O)C(CCCCC(=O)O)O1.COC(=O)CCCCC(O)C(=O)O |
| InChI | InChI=1S/C10H16O5.C8H14O5/c1-10(2)14-7(9(13)15-10)5-3-4-6-8(11)12;1-13-7(10)5-3-2-4-6(9)8(11)12/h7H,3-6H2,1-2H3,(H,11,12);6,9H,2-5H2,1H3,(H,11,12) |
| InChIKey | YVRCPSBRYLLRQB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|