C20H36O5 — CID 10882822
methyl 8-[(4R,5R)-2,2-dimethyl-5-(6-oxohexyl)-1,3-dioxolan-4-yl]octanoate (PubChem CID 10882822) has the molecular formula C20H36O5 and a molecular weight of 356.50 g/mol. Its IUPAC name is methyl 8-[(4R,5R)-2,2-dimethyl-5-(6-oxohexyl)-1,3-dioxolan-4-yl]octanoate.
| Compound Name | methyl 8-[(4R,5R)-2,2-dimethyl-5-(6-oxohexyl)-1,3-dioxolan-4-yl]octanoate |
|---|---|
| PubChem CID | 10882822 |
| Molecular Formula | C20H36O5 |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | methyl 8-[(4R,5R)-2,2-dimethyl-5-(6-oxohexyl)-1,3-dioxolan-4-yl]octanoate |
| SMILES | COC(=O)CCCCCCC[C@H]1OC(C)(C)O[C@@H]1CCCCCC=O |
| InChI | InChI=1S/C20H36O5/c1-20(2)24-17(18(25-20)14-10-7-8-12-16-21)13-9-5-4-6-11-15-19(22)23-3/h16-18H,4-15H2,1-3H3/t17-,18-/m1/s1 |
| InChIKey | GKIWMIBVPGCITM-QZTJIDSGSA-N |
| XLogP | 4.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|