About methyl 10-oxodecanoate
methyl 10-oxodecanoate (PubChem CID 519005) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is methyl 10-oxodecanoate.
Molecular Properties
| Compound Name | methyl 10-oxodecanoate |
| PubChem CID | 519005 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | methyl 10-oxodecanoate |
| SMILES | COC(=O)CCCCCCCCC=O |
| InChI | InChI=1S/C11H20O3/c1-14-11(13)9-7-5-3-2-4-6-8-10-12/h10H,2-9H2,1H3 |
| InChIKey | LVPNLDGNIRVDRF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 10-oxodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 10-oxodecanoate?
The IUPAC name of methyl 10-oxodecanoate (CID 519005) is methyl 10-oxodecanoate.
What is the SMILES notation for methyl 10-oxodecanoate?
The canonical SMILES for methyl 10-oxodecanoate is COC(=O)CCCCCCCCC=O.
What is the InChIKey of methyl 10-oxodecanoate?
The InChIKey is LVPNLDGNIRVDRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-14-11(13)9-7-5-3-2-4-6-8-10-12/h10H,2-9H2,1H3.
What are the key properties of methyl 10-oxodecanoate?
methyl 10-oxodecanoate has a molecular weight of 200.28 g/mol, XLogP of 2.48, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 10-oxodecanoate is sourced from PubChem (CID 519005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).